C16H25CoN2O- — CID 155747938
N-[3-(2-aminoethyl)phenyl]-2-propylpentanamide;cobalt (PubChem CID 155747938) has the molecular formula C16H25CoN2O- and a molecular weight of 320.32 g/mol. Its IUPAC name is N-[3-(2-aminoethyl)phenyl]-2-propylpentanamide;cobalt.
| Compound Name | N-[3-(2-aminoethyl)phenyl]-2-propylpentanamide;cobalt |
|---|---|
| PubChem CID | 155747938 |
| Molecular Formula | C16H25CoN2O- |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-[3-(2-aminoethyl)phenyl]-2-propylpentanamide;cobalt |
| SMILES | CCCC(CCC)C(=O)Nc1cccc(C[CH-]N)c1.[Co] |
| InChI | InChI=1S/C16H25N2O.Co/c1-3-6-14(7-4-2)16(19)18-15-9-5-8-13(12-15)10-11-17;/h5,8-9,11-12,14H,3-4,6-7,10,17H2,1-2H3,(H,18,19);/q-1; |
| InChIKey | ZOOIZHHJXSKRER-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|