C12H20N4O3S — CID 65225216
2-(aminomethyl)-N-[3-(sulfamoylamino)phenyl]pentanamide (PubChem CID 65225216) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[3-(sulfamoylamino)phenyl]pentanamide.
| Compound Name | 2-(aminomethyl)-N-[3-(sulfamoylamino)phenyl]pentanamide |
|---|---|
| PubChem CID | 65225216 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-(aminomethyl)-N-[3-(sulfamoylamino)phenyl]pentanamide |
| SMILES | CCCC(CN)C(=O)Nc1cccc(NS(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H20N4O3S/c1-2-4-9(8-13)12(17)15-10-5-3-6-11(7-10)16-20(14,18)19/h3,5-7,9,16H,2,4,8,13H2,1H3,(H,15,17)(H2,14,18,19) |
| InChIKey | ILCQIWSTAWPBKF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |