C13H21N3O3S — CID 65225091
2-(aminomethyl)-N-[3-(methylsulfamoyl)phenyl]pentanamide (PubChem CID 65225091) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[3-(methylsulfamoyl)phenyl]pentanamide.
| Compound Name | 2-(aminomethyl)-N-[3-(methylsulfamoyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 65225091 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-(aminomethyl)-N-[3-(methylsulfamoyl)phenyl]pentanamide |
| SMILES | CCCC(CN)C(=O)Nc1cccc(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C13H21N3O3S/c1-3-5-10(9-14)13(17)16-11-6-4-7-12(8-11)20(18,19)15-2/h4,6-8,10,15H,3,5,9,14H2,1-2H3,(H,16,17) |
| InChIKey | VMMIQSQUCBDACG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |