C10H15N3O3S — CID 51885688
(2R)-2-amino-N-[3-(methylsulfamoyl)phenyl]propanamide (PubChem CID 51885688) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is (2R)-2-amino-N-[3-(methylsulfamoyl)phenyl]propanamide.
| Compound Name | (2R)-2-amino-N-[3-(methylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 51885688 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (2R)-2-amino-N-[3-(methylsulfamoyl)phenyl]propanamide |
| SMILES | CNS(=O)(=O)c1cccc(NC(=O)[C@@H](C)N)c1 |
| InChI | InChI=1S/C10H15N3O3S/c1-7(11)10(14)13-8-4-3-5-9(6-8)17(15,16)12-2/h3-7,12H,11H2,1-2H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | ZANSOQZCUCIROE-SSDOTTSWSA-N |
| XLogP | -0.12 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |