C26H21NO — CID 7039734
(1R)-N-naphthalen-2-yl-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 7039734) has the molecular formula C26H21NO and a molecular weight of 363.46 g/mol. Its IUPAC name is (1R)-N-naphthalen-2-yl-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1R)-N-naphthalen-2-yl-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7039734 |
| Molecular Formula | C26H21NO |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (1R)-N-naphthalen-2-yl-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc2ccccc2c1)[C@@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H21NO/c28-25(27-23-16-15-19-9-7-8-10-20(19)17-23)24-18-26(24,21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1-17,24H,18H2,(H,27,28)/t24-/m0/s1 |
| InChIKey | XBWJDIDBBVALIY-DEOSSOPVSA-N |
| XLogP | 5.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |