C28H24N2O — CID 7452248
(1R)-N-[(Z)-1-naphthalen-2-ylethylideneamino]-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 7452248) has the molecular formula C28H24N2O and a molecular weight of 404.51 g/mol. Its IUPAC name is (1R)-N-[(Z)-1-naphthalen-2-ylethylideneamino]-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1R)-N-[(Z)-1-naphthalen-2-ylethylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7452248 |
| Molecular Formula | C28H24N2O |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (1R)-N-[(Z)-1-naphthalen-2-ylethylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | C/C(=N/NC(=O)[C@@H]1CC1(c1ccccc1)c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H24N2O/c1-20(22-17-16-21-10-8-9-11-23(21)18-22)29-30-27(31)26-19-28(26,24-12-4-2-5-13-24)25-14-6-3-7-15-25/h2-18,26H,19H2,1H3,(H,30,31)/b29-20-/t26-/m0/s1 |
| InChIKey | WTWUTNTZPQGTDH-CTTMAIQESA-N |
| XLogP | 5.69 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|