C24H23NO — CID 2844054
N-(2,5-dimethylphenyl)-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 2844054) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 2844054 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C2CC2(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H23NO/c1-17-13-14-18(2)22(15-17)25-23(26)21-16-24(21,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-15,21H,16H2,1-2H3,(H,25,26) |
| InChIKey | BTXCKOBJSIDBNO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |