C27H28N2O — CID 129438757
(1R)-N-[1-(4-methylphenyl)butylideneamino]-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 129438757) has the molecular formula C27H28N2O and a molecular weight of 396.53 g/mol. Its IUPAC name is (1R)-N-[1-(4-methylphenyl)butylideneamino]-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1R)-N-[1-(4-methylphenyl)butylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 129438757 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (1R)-N-[1-(4-methylphenyl)butylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | CCCC(=NNC(=O)[C@@H]1CC1(c1ccccc1)c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H28N2O/c1-3-10-25(21-17-15-20(2)16-18-21)28-29-26(30)24-19-27(24,22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-9,11-18,24H,3,10,19H2,1-2H3,(H,29,30)/t24-/m0/s1 |
| InChIKey | IJDCOZSTTWKZLO-DEOSSOPVSA-N |
| XLogP | 5.62 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|