C27H28N2O — CID 7285249
(1S)-2,2-diphenyl-N-[(Z)-1-phenylpentylideneamino]cyclopropane-1-carboxamide (PubChem CID 7285249) has the molecular formula C27H28N2O and a molecular weight of 396.53 g/mol. Its IUPAC name is (1S)-2,2-diphenyl-N-[(Z)-1-phenylpentylideneamino]cyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-diphenyl-N-[(Z)-1-phenylpentylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7285249 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (1S)-2,2-diphenyl-N-[(Z)-1-phenylpentylideneamino]cyclopropane-1-carboxamide |
| SMILES | CCCC/C(=N/NC(=O)[C@H]1CC1(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O/c1-2-3-19-25(21-13-7-4-8-14-21)28-29-26(30)24-20-27(24,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,24H,2-3,19-20H2,1H3,(H,29,30)/b28-25-/t24-/m1/s1 |
| InChIKey | BIDRUTJBAYJPOF-UPIHBEMDSA-N |
| XLogP | 5.70 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|