C15H29N5O3 — CID 102288656
(2S)-N-butyl-2-[(butylcarbamoylamino)carbamoyl]pyrrolidine-1-carboxamide (PubChem CID 102288656) has the molecular formula C15H29N5O3 and a molecular weight of 327.43 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(butylcarbamoylamino)carbamoyl]pyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-butyl-2-[(butylcarbamoylamino)carbamoyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 102288656 |
| Molecular Formula | C15H29N5O3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | (2S)-N-butyl-2-[(butylcarbamoylamino)carbamoyl]pyrrolidine-1-carboxamide |
| SMILES | CCCCNC(=O)NNC(=O)[C@@H]1CCCN1C(=O)NCCCC |
| InChI | InChI=1S/C15H29N5O3/c1-3-5-9-16-14(22)19-18-13(21)12-8-7-11-20(12)15(23)17-10-6-4-2/h12H,3-11H2,1-2H3,(H,17,23)(H,18,21)(H2,16,19,22)/t12-/m0/s1 |
| InChIKey | CSKLDEGXMCDXHM-LBPRGKRZSA-N |
| XLogP | 1.09 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|