C18H22FN5O2S — CID 7412054
(2R)-1-N-butyl-2-N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-1,2-dicarboxamide (PubChem CID 7412054) has the molecular formula C18H22FN5O2S and a molecular weight of 391.47 g/mol. Its IUPAC name is (2R)-1-N-butyl-2-N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-1-N-butyl-2-N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 7412054 |
| Molecular Formula | C18H22FN5O2S |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (2R)-1-N-butyl-2-N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-1,2-dicarboxamide |
| SMILES | CCCCNC(=O)N1CCC[C@@H]1C(=O)Nc1nnc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C18H22FN5O2S/c1-2-3-10-20-18(26)24-11-4-5-14(24)15(25)21-17-23-22-16(27-17)12-6-8-13(19)9-7-12/h6-9,14H,2-5,10-11H2,1H3,(H,20,26)(H,21,23,25)/t14-/m1/s1 |
| InChIKey | XQRKZDHIOYLEIH-CQSZACIVSA-N |
| XLogP | 3.26 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|