C19H23N5O4S — CID 3680835
2-N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-1-N-butylpyrrolidine-1,2-dicarboxamide (PubChem CID 3680835) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-1-N-butylpyrrolidine-1,2-dicarboxamide.
| Compound Name | 2-N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-1-N-butylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 3680835 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-1-N-butylpyrrolidine-1,2-dicarboxamide |
| SMILES | CCCCNC(=O)N1CCCC1C(=O)Nc1nnc(-c2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C19H23N5O4S/c1-2-3-8-20-19(26)24-9-4-5-13(24)16(25)21-18-23-22-17(29-18)12-6-7-14-15(10-12)28-11-27-14/h6-7,10,13H,2-5,8-9,11H2,1H3,(H,20,26)(H,21,23,25) |
| InChIKey | WIQCAXNKMKVJJA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|