C27H30N4O4S — CID 3447228
N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-1-(4-hexylbenzoyl)pyrrolidine-2-carboxamide (PubChem CID 3447228) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-1-(4-hexylbenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-1-(4-hexylbenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 3447228 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-1-(4-hexylbenzoyl)pyrrolidine-2-carboxamide |
| SMILES | CCCCCCc1ccc(C(=O)N2CCCC2C(=O)Nc2nnc(-c3ccc4c(c3)OCO4)s2)cc1 |
| InChI | InChI=1S/C27H30N4O4S/c1-2-3-4-5-7-18-9-11-19(12-10-18)26(33)31-15-6-8-21(31)24(32)28-27-30-29-25(36-27)20-13-14-22-23(16-20)35-17-34-22/h9-14,16,21H,2-8,15,17H2,1H3,(H,28,30,32) |
| InChIKey | YYTRXQFZGHNCBQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|