C26H29BrN4O2S — CID 4529748
N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-1-(4-hexylbenzoyl)pyrrolidine-2-carboxamide (PubChem CID 4529748) has the molecular formula C26H29BrN4O2S and a molecular weight of 541.52 g/mol. Its IUPAC name is N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-1-(4-hexylbenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-1-(4-hexylbenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 4529748 |
| Molecular Formula | C26H29BrN4O2S |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-1-(4-hexylbenzoyl)pyrrolidine-2-carboxamide |
| SMILES | CCCCCCc1ccc(C(=O)N2CCCC2C(=O)Nc2nnc(-c3ccc(Br)cc3)s2)cc1 |
| InChI | InChI=1S/C26H29BrN4O2S/c1-2-3-4-5-7-18-9-11-20(12-10-18)25(33)31-17-6-8-22(31)23(32)28-26-30-29-24(34-26)19-13-15-21(27)16-14-19/h9-16,22H,2-8,17H2,1H3,(H,28,30,32) |
| InChIKey | NTYGWSDWUYSFSF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|