C19H23FN4O2S — CID 7288689
(2S)-N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-1-hexanoylpyrrolidine-2-carboxamide (PubChem CID 7288689) has the molecular formula C19H23FN4O2S and a molecular weight of 390.48 g/mol. Its IUPAC name is (2S)-N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-1-hexanoylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-1-hexanoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 7288689 |
| Molecular Formula | C19H23FN4O2S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (2S)-N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-1-hexanoylpyrrolidine-2-carboxamide |
| SMILES | CCCCCC(=O)N1CCC[C@H]1C(=O)Nc1nnc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C19H23FN4O2S/c1-2-3-4-7-16(25)24-12-5-6-15(24)17(26)21-19-23-22-18(27-19)13-8-10-14(20)11-9-13/h8-11,15H,2-7,12H2,1H3,(H,21,23,26)/t15-/m0/s1 |
| InChIKey | VWBJJDCNGCGXEY-HNNXBMFYSA-N |
| XLogP | 3.85 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|