C24H25ClN4O3S — CID 42662187
1-(4-butoxybenzoyl)-N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2-carboxamide (PubChem CID 42662187) has the molecular formula C24H25ClN4O3S and a molecular weight of 485.01 g/mol. Its IUPAC name is 1-(4-butoxybenzoyl)-N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-butoxybenzoyl)-N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 42662187 |
| Molecular Formula | C24H25ClN4O3S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 1-(4-butoxybenzoyl)-N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CCCCOc1ccc(C(=O)N2CCCC2C(=O)Nc2nnc(-c3ccc(Cl)cc3)s2)cc1 |
| InChI | InChI=1S/C24H25ClN4O3S/c1-2-3-15-32-19-12-8-17(9-13-19)23(31)29-14-4-5-20(29)21(30)26-24-28-27-22(33-24)16-6-10-18(25)11-7-16/h6-13,20H,2-5,14-15H2,1H3,(H,26,28,30) |
| InChIKey | COMKNLKZHGUNPS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|