C22H29ClN4O2S — CID 98396532
(2S)-N-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-1-nonanoylpyrrolidine-2-carboxamide (PubChem CID 98396532) has the molecular formula C22H29ClN4O2S and a molecular weight of 449.02 g/mol. Its IUPAC name is (2S)-N-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-1-nonanoylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-1-nonanoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 98396532 |
| Molecular Formula | C22H29ClN4O2S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (2S)-N-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-1-nonanoylpyrrolidine-2-carboxamide |
| SMILES | CCCCCCCCC(=O)N1CCC[C@H]1C(=O)Nc1nnc(-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C22H29ClN4O2S/c1-2-3-4-5-6-7-13-19(28)27-14-9-12-18(27)20(29)24-22-26-25-21(30-22)16-10-8-11-17(23)15-16/h8,10-11,15,18H,2-7,9,12-14H2,1H3,(H,24,26,29)/t18-/m0/s1 |
| InChIKey | QOIDQVPCPJEQQT-SFHVURJKSA-N |
| XLogP | 5.54 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|