C16H32BN3O4 — CID 143689897
[[1-(nonylcarbamoyl)pyrrolidine-2-carbonyl]amino]methylboronic acid (PubChem CID 143689897) has the molecular formula C16H32BN3O4 and a molecular weight of 341.26 g/mol. Its IUPAC name is [[1-(nonylcarbamoyl)pyrrolidine-2-carbonyl]amino]methylboronic acid.
| Compound Name | [[1-(nonylcarbamoyl)pyrrolidine-2-carbonyl]amino]methylboronic acid |
|---|---|
| PubChem CID | 143689897 |
| Molecular Formula | C16H32BN3O4 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | [[1-(nonylcarbamoyl)pyrrolidine-2-carbonyl]amino]methylboronic acid |
| SMILES | CCCCCCCCCNC(=O)N1CCCC1C(=O)NCB(O)O |
| InChI | InChI=1S/C16H32BN3O4/c1-2-3-4-5-6-7-8-11-18-16(22)20-12-9-10-14(20)15(21)19-13-17(23)24/h14,23-24H,2-13H2,1H3,(H,18,22)(H,19,21) |
| InChIKey | XJXKPWCMNAZELW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|