C18H32F3N5O2 — CID 55807237
1-N-[4-(4-ethylpiperazin-1-yl)butyl]-2-N-(2,2,2-trifluoroethyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 55807237) has the molecular formula C18H32F3N5O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is 1-N-[4-(4-ethylpiperazin-1-yl)butyl]-2-N-(2,2,2-trifluoroethyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 1-N-[4-(4-ethylpiperazin-1-yl)butyl]-2-N-(2,2,2-trifluoroethyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 55807237 |
| Molecular Formula | C18H32F3N5O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 1-N-[4-(4-ethylpiperazin-1-yl)butyl]-2-N-(2,2,2-trifluoroethyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | CCN1CCN(CCCCNC(=O)N2CCCC2C(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H32F3N5O2/c1-2-24-10-12-25(13-11-24)8-4-3-7-22-17(28)26-9-5-6-15(26)16(27)23-14-18(19,20)21/h15H,2-14H2,1H3,(H,22,28)(H,23,27) |
| InChIKey | JNECPMUBVSBZGL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|