C10H9FN2O4 — CID 142439082
N-(4-fluorophenyl)-3-hydroxy-5-oxo-1,2-oxazolidine-4-carboxamide (PubChem CID 142439082) has the molecular formula C10H9FN2O4 and a molecular weight of 240.19 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-hydroxy-5-oxo-1,2-oxazolidine-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-3-hydroxy-5-oxo-1,2-oxazolidine-4-carboxamide |
|---|---|
| PubChem CID | 142439082 |
| Molecular Formula | C10H9FN2O4 |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | N-(4-fluorophenyl)-3-hydroxy-5-oxo-1,2-oxazolidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1C(=O)ONC1O |
| InChI | InChI=1S/C10H9FN2O4/c11-5-1-3-6(4-2-5)12-8(14)7-9(15)13-17-10(7)16/h1-4,7,9,13,15H,(H,12,14) |
| InChIKey | ZQPVYYBTHWYYJZ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|