C10H9FN2O3 — CID 110649976
N-(4-fluorophenyl)-2-oxo-1,3-oxazolidine-4-carboxamide (PubChem CID 110649976) has the molecular formula C10H9FN2O3 and a molecular weight of 224.19 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-oxo-1,3-oxazolidine-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2-oxo-1,3-oxazolidine-4-carboxamide |
|---|---|
| PubChem CID | 110649976 |
| Molecular Formula | C10H9FN2O3 |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | N-(4-fluorophenyl)-2-oxo-1,3-oxazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)Nc2ccc(F)cc2)CO1 |
| InChI | InChI=1S/C10H9FN2O3/c11-6-1-3-7(4-2-6)12-9(14)8-5-16-10(15)13-8/h1-4,8H,5H2,(H,12,14)(H,13,15) |
| InChIKey | AYRWMERSKIGJMG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |