C16H13FN2O3 — CID 110689144
N-(4-fluorophenyl)-2-oxo-5-phenyl-1,3-oxazolidine-4-carboxamide (PubChem CID 110689144) has the molecular formula C16H13FN2O3 and a molecular weight of 300.29 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-oxo-5-phenyl-1,3-oxazolidine-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2-oxo-5-phenyl-1,3-oxazolidine-4-carboxamide |
|---|---|
| PubChem CID | 110689144 |
| Molecular Formula | C16H13FN2O3 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-(4-fluorophenyl)-2-oxo-5-phenyl-1,3-oxazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)Nc2ccc(F)cc2)C(c2ccccc2)O1 |
| InChI | InChI=1S/C16H13FN2O3/c17-11-6-8-12(9-7-11)18-15(20)13-14(22-16(21)19-13)10-4-2-1-3-5-10/h1-9,13-14H,(H,18,20)(H,19,21) |
| InChIKey | NLQOTOCLCGGEGL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |