C18H15FN2O3 — CID 91538570
N-(4-fluorophenyl)-2,4-dioxo-6-phenylpiperidine-3-carboxamide (PubChem CID 91538570) has the molecular formula C18H15FN2O3 and a molecular weight of 326.33 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2,4-dioxo-6-phenylpiperidine-3-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2,4-dioxo-6-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 91538570 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-(4-fluorophenyl)-2,4-dioxo-6-phenylpiperidine-3-carboxamide |
| SMILES | O=C1CC(c2ccccc2)NC(=O)C1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN2O3/c19-12-6-8-13(9-7-12)20-17(23)16-15(22)10-14(21-18(16)24)11-4-2-1-3-5-11/h1-9,14,16H,10H2,(H,20,23)(H,21,24) |
| InChIKey | NNZFNZNNUMZKDF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|