C12H11NO3 — CID 75388196
2,5-dioxo-N-phenylcyclopentane-1-carboxamide (PubChem CID 75388196) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 2,5-dioxo-N-phenylcyclopentane-1-carboxamide.
| Compound Name | 2,5-dioxo-N-phenylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 75388196 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2,5-dioxo-N-phenylcyclopentane-1-carboxamide |
| SMILES | O=C1CCC(=O)C1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H11NO3/c14-9-6-7-10(15)11(9)12(16)13-8-4-2-1-3-5-8/h1-5,11H,6-7H2,(H,13,16) |
| InChIKey | IHNPRFMLPUUXJV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|