C15H12N2O2 — CID 134112326
2-oxo-N-phenyl-1,3-dihydroindole-3-carboxamide (PubChem CID 134112326) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-oxo-N-phenyl-1,3-dihydroindole-3-carboxamide.
| Compound Name | 2-oxo-N-phenyl-1,3-dihydroindole-3-carboxamide |
|---|---|
| PubChem CID | 134112326 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-oxo-N-phenyl-1,3-dihydroindole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C15H12N2O2/c18-14(16-10-6-2-1-3-7-10)13-11-8-4-5-9-12(11)17-15(13)19/h1-9,13H,(H,16,18)(H,17,19) |
| InChIKey | RVPIGWJIDHZSBT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|