C18H14N2O4 — CID 2323488
N-(4-acetylphenyl)-2-oxo-2-[(3R)-2-oxo-1,3-dihydroindol-3-yl]acetamide (PubChem CID 2323488) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-oxo-2-[(3R)-2-oxo-1,3-dihydroindol-3-yl]acetamide.
| Compound Name | N-(4-acetylphenyl)-2-oxo-2-[(3R)-2-oxo-1,3-dihydroindol-3-yl]acetamide |
|---|---|
| PubChem CID | 2323488 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(4-acetylphenyl)-2-oxo-2-[(3R)-2-oxo-1,3-dihydroindol-3-yl]acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(=O)[C@@H]2C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C18H14N2O4/c1-10(21)11-6-8-12(9-7-11)19-18(24)16(22)15-13-4-2-3-5-14(13)20-17(15)23/h2-9,15H,1H3,(H,19,24)(H,20,23)/t15-/m1/s1 |
| InChIKey | IPOJFFZLLVTEKL-OAHLLOKOSA-N |
| XLogP | 2.13 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|