C16H18N2O3 — CID 4245545
N-cyclohexyl-2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide (PubChem CID 4245545) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-cyclohexyl-2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide.
| Compound Name | N-cyclohexyl-2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide |
|---|---|
| PubChem CID | 4245545 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-cyclohexyl-2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide |
| SMILES | O=C(NC1CCCCC1)C(=O)C1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C16H18N2O3/c19-14(16(21)17-10-6-2-1-3-7-10)13-11-8-4-5-9-12(11)18-15(13)20/h4-5,8-10,13H,1-3,6-7H2,(H,17,21)(H,18,20) |
| InChIKey | AMIROQNUGSOKRG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|