C16H11FN2O3 — CID 3331949
N-(4-fluorophenyl)-2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide (PubChem CID 3331949) has the molecular formula C16H11FN2O3 and a molecular weight of 298.27 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide.
| Compound Name | N-(4-fluorophenyl)-2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide |
|---|---|
| PubChem CID | 3331949 |
| Molecular Formula | C16H11FN2O3 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N-(4-fluorophenyl)-2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide |
| SMILES | O=C(Nc1ccc(F)cc1)C(=O)C1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C16H11FN2O3/c17-9-5-7-10(8-6-9)18-16(22)14(20)13-11-3-1-2-4-12(11)19-15(13)21/h1-8,13H,(H,18,22)(H,19,21) |
| InChIKey | NXZASYPXSSHAEY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|