C14H16N2O3 — CID 3698854
N-butyl-2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide (PubChem CID 3698854) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is N-butyl-2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide.
| Compound Name | N-butyl-2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide |
|---|---|
| PubChem CID | 3698854 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-butyl-2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide |
| SMILES | CCCCNC(=O)C(=O)C1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C14H16N2O3/c1-2-3-8-15-14(19)12(17)11-9-6-4-5-7-10(9)16-13(11)18/h4-7,11H,2-3,8H2,1H3,(H,15,19)(H,16,18) |
| InChIKey | TWBPXQJGBAHJNH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|