C23H19N3O6S — CID 98430375
N-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-oxo-2-[(3S)-2-oxo-1,3-dihydroindol-3-yl]acetamide (PubChem CID 98430375) has the molecular formula C23H19N3O6S and a molecular weight of 465.49 g/mol. Its IUPAC name is N-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-oxo-2-[(3S)-2-oxo-1,3-dihydroindol-3-yl]acetamide.
| Compound Name | N-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-oxo-2-[(3S)-2-oxo-1,3-dihydroindol-3-yl]acetamide |
|---|---|
| PubChem CID | 98430375 |
| Molecular Formula | C23H19N3O6S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | N-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-oxo-2-[(3S)-2-oxo-1,3-dihydroindol-3-yl]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(NC(=O)C(=O)[C@H]3C(=O)Nc4ccccc43)c2)cc1 |
| InChI | InChI=1S/C23H19N3O6S/c1-32-16-11-9-14(10-12-16)26-33(30,31)17-6-4-5-15(13-17)24-23(29)21(27)20-18-7-2-3-8-19(18)25-22(20)28/h2-13,20,26H,1H3,(H,24,29)(H,25,28)/t20-/m0/s1 |
| InChIKey | DQKNUDINAHVWCS-FQEVSTJZSA-N |
| XLogP | 2.74 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|