C17H22N2O2 — CID 110730173
N-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]cyclohexanecarboxamide (PubChem CID 110730173) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is N-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 110730173 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]cyclohexanecarboxamide |
| SMILES | O=C(NCCC1C(=O)Nc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C17H22N2O2/c20-16(12-6-2-1-3-7-12)18-11-10-14-13-8-4-5-9-15(13)19-17(14)21/h4-5,8-9,12,14H,1-3,6-7,10-11H2,(H,18,20)(H,19,21) |
| InChIKey | BWAKULYFJOSRLU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |