C17H15ClN2O2 — CID 110730209
4-chloro-N-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]benzamide (PubChem CID 110730209) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is 4-chloro-N-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110730209 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 4-chloro-N-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]benzamide |
| SMILES | O=C(NCCC1C(=O)Nc2ccccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2O2/c18-12-7-5-11(6-8-12)16(21)19-10-9-14-13-3-1-2-4-15(13)20-17(14)22/h1-8,14H,9-10H2,(H,19,21)(H,20,22) |
| InChIKey | FQUYQWWOTQRWRG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |