C11H17N3O3 — CID 110722103
N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]cyclopentanecarboxamide (PubChem CID 110722103) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 110722103 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]cyclopentanecarboxamide |
| SMILES | O=C1NC(=O)C(CCNC(=O)C2CCCC2)N1 |
| InChI | InChI=1S/C11H17N3O3/c15-9(7-3-1-2-4-7)12-6-5-8-10(16)14-11(17)13-8/h7-8H,1-6H2,(H,12,15)(H2,13,14,16,17) |
| InChIKey | QFEGYBYQFJETEV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|