C12H13ClN4O3 — CID 110748119
1-(3-chlorophenyl)-3-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]urea (PubChem CID 110748119) has the molecular formula C12H13ClN4O3 and a molecular weight of 296.71 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 110748119 |
| Molecular Formula | C12H13ClN4O3 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]urea |
| SMILES | O=C(NCCC1NC(=O)NC1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H13ClN4O3/c13-7-2-1-3-8(6-7)15-11(19)14-5-4-9-10(18)17-12(20)16-9/h1-3,6,9H,4-5H2,(H2,14,15,19)(H2,16,17,18,20) |
| InChIKey | KJRNWIKSIWUDIM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|