C16H13NO — CID 6990829
(3R)-3-(1-phenylethenyl)-1,3-dihydroindol-2-one (PubChem CID 6990829) has the molecular formula C16H13NO and a molecular weight of 235.29 g/mol. Its IUPAC name is (3R)-3-(1-phenylethenyl)-1,3-dihydroindol-2-one.
| Compound Name | (3R)-3-(1-phenylethenyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 6990829 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (3R)-3-(1-phenylethenyl)-1,3-dihydroindol-2-one |
| SMILES | C=C(c1ccccc1)[C@H]1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C16H13NO/c1-11(12-7-3-2-4-8-12)15-13-9-5-6-10-14(13)17-16(15)18/h2-10,15H,1H2,(H,17,18)/t15-/m1/s1 |
| InChIKey | UILSLWXGVBQAFD-OAHLLOKOSA-N |
| XLogP | 3.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |