C8H9N2O+ — CID 6921460
[(3R)-2-oxo-1,3-dihydroindol-3-yl]azanium (PubChem CID 6921460) has the molecular formula C8H9N2O+ and a molecular weight of 149.17 g/mol. Its IUPAC name is [(3R)-2-oxo-1,3-dihydroindol-3-yl]azanium.
| Compound Name | [(3R)-2-oxo-1,3-dihydroindol-3-yl]azanium |
|---|---|
| PubChem CID | 6921460 |
| Molecular Formula | C8H9N2O+ |
| Molecular Weight | 149.17 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | [(3R)-2-oxo-1,3-dihydroindol-3-yl]azanium |
| SMILES | [NH3+][C@H]1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C8H8N2O/c9-7-5-3-1-2-4-6(5)10-8(7)11/h1-4,7H,9H2,(H,10,11)/p+1/t7-/m1/s1 |
| InChIKey | KOURBIFKJIEMRK-SSDOTTSWSA-O |
| XLogP | -0.08 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.17 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |