C10H9NO2 — CID 22380583
2-(2-oxo-1,3-dihydroindol-3-yl)acetaldehyde (PubChem CID 22380583) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 2-(2-oxo-1,3-dihydroindol-3-yl)acetaldehyde.
| Compound Name | 2-(2-oxo-1,3-dihydroindol-3-yl)acetaldehyde |
|---|---|
| PubChem CID | 22380583 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2-(2-oxo-1,3-dihydroindol-3-yl)acetaldehyde |
| SMILES | O=CCC1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C10H9NO2/c12-6-5-8-7-3-1-2-4-9(7)11-10(8)13/h1-4,6,8H,5H2,(H,11,13) |
| InChIKey | BJLIGRDZDRGQOE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|