C14H17N3O3 — CID 110694642
N-(2-acetamidoethyl)-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide (PubChem CID 110694642) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide |
|---|---|
| PubChem CID | 110694642 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(2-acetamidoethyl)-2-(2-oxo-1,3-dihydroindol-3-yl)acetamide |
| SMILES | CC(=O)NCCNC(=O)CC1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C14H17N3O3/c1-9(18)15-6-7-16-13(19)8-11-10-4-2-3-5-12(10)17-14(11)20/h2-5,11H,6-8H2,1H3,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | HXFIXOGSRSCCMW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|