C9H8NO2S+ — CID 175320984
oxo-[(2-oxo-1,3-dihydroindol-3-yl)methyl]sulfanium (PubChem CID 175320984) has the molecular formula C9H8NO2S+ and a molecular weight of 194.23 g/mol. Its IUPAC name is oxo-[(2-oxo-1,3-dihydroindol-3-yl)methyl]sulfanium.
| Compound Name | oxo-[(2-oxo-1,3-dihydroindol-3-yl)methyl]sulfanium |
|---|---|
| PubChem CID | 175320984 |
| Molecular Formula | C9H8NO2S+ |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | oxo-[(2-oxo-1,3-dihydroindol-3-yl)methyl]sulfanium |
| SMILES | O=[S+]CC1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C9H7NO2S/c11-9-7(5-13-12)6-3-1-2-4-8(6)10-9/h1-4,7H,5H2/p+1 |
| InChIKey | GVMZXBWSIISLRI-UHFFFAOYSA-O |
| XLogP | 1.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|