C13H11NOS — CID 2803153
3-(thiophen-2-ylmethyl)-1,3-dihydroindol-2-one (PubChem CID 2803153) has the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. Its IUPAC name is 3-(thiophen-2-ylmethyl)-1,3-dihydroindol-2-one.
| Compound Name | 3-(thiophen-2-ylmethyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 2803153 |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 3-(thiophen-2-ylmethyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccccc2C1Cc1cccs1 |
| InChI | InChI=1S/C13H11NOS/c15-13-11(8-9-4-3-7-16-9)10-5-1-2-6-12(10)14-13/h1-7,11H,8H2,(H,14,15) |
| InChIKey | LMYJZLPZMDKYGL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |