C14H18N2O — CID 43370920
3-(cyclopentylmethylamino)-1,3-dihydroindol-2-one (PubChem CID 43370920) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-(cyclopentylmethylamino)-1,3-dihydroindol-2-one.
| Compound Name | 3-(cyclopentylmethylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43370920 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3-(cyclopentylmethylamino)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccccc2C1NCC1CCCC1 |
| InChI | InChI=1S/C14H18N2O/c17-14-13(15-9-10-5-1-2-6-10)11-7-3-4-8-12(11)16-14/h3-4,7-8,10,13,15H,1-2,5-6,9H2,(H,16,17) |
| InChIKey | FXZNMPVPIBJWID-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |