C10H11N3O2 — CID 16770871
2-[(2-oxo-1,3-dihydroindol-3-yl)amino]acetamide (PubChem CID 16770871) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-[(2-oxo-1,3-dihydroindol-3-yl)amino]acetamide.
| Compound Name | 2-[(2-oxo-1,3-dihydroindol-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 16770871 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-[(2-oxo-1,3-dihydroindol-3-yl)amino]acetamide |
| SMILES | NC(=O)CNC1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C10H11N3O2/c11-8(14)5-12-9-6-3-1-2-4-7(6)13-10(9)15/h1-4,9,12H,5H2,(H2,11,14)(H,13,15) |
| InChIKey | SLTKLRFMRSGBIE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |