C16H14N2O3 — CID 43139137
methyl 4-[(2-oxo-1,3-dihydroindol-3-yl)amino]benzoate (PubChem CID 43139137) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is methyl 4-[(2-oxo-1,3-dihydroindol-3-yl)amino]benzoate.
| Compound Name | methyl 4-[(2-oxo-1,3-dihydroindol-3-yl)amino]benzoate |
|---|---|
| PubChem CID | 43139137 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | methyl 4-[(2-oxo-1,3-dihydroindol-3-yl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC2C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C16H14N2O3/c1-21-16(20)10-6-8-11(9-7-10)17-14-12-4-2-3-5-13(12)18-15(14)19/h2-9,14,17H,1H3,(H,18,19) |
| InChIKey | NGODGXTUPBVTTK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |