C15H12FN3O2 — CID 43193021
4-[(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)amino]benzamide (PubChem CID 43193021) has the molecular formula C15H12FN3O2 and a molecular weight of 285.28 g/mol. Its IUPAC name is 4-[(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)amino]benzamide.
| Compound Name | 4-[(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 43193021 |
| Molecular Formula | C15H12FN3O2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 4-[(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)amino]benzamide |
| SMILES | NC(=O)c1ccc(NC2C(=O)Nc3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C15H12FN3O2/c16-9-3-6-11-12(7-9)19-15(21)13(11)18-10-4-1-8(2-5-10)14(17)20/h1-7,13,18H,(H2,17,20)(H,19,21) |
| InChIKey | CHPVPNKTKZOJDU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |