C15H11FN2O3 — CID 43321623
4-[(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)amino]benzoic acid (PubChem CID 43321623) has the molecular formula C15H11FN2O3 and a molecular weight of 286.26 g/mol. Its IUPAC name is 4-[(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)amino]benzoic acid.
| Compound Name | 4-[(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 43321623 |
| Molecular Formula | C15H11FN2O3 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-[(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC2C(=O)Nc3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C15H11FN2O3/c16-9-3-6-11-12(7-9)18-14(19)13(11)17-10-4-1-8(2-5-10)15(20)21/h1-7,13,17H,(H,18,19)(H,20,21) |
| InChIKey | OQTDVYDBBZJJON-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |