C15H12BrFN2O — CID 43192669
3-(4-bromo-3-methylanilino)-6-fluoro-1,3-dihydroindol-2-one (PubChem CID 43192669) has the molecular formula C15H12BrFN2O and a molecular weight of 335.18 g/mol. Its IUPAC name is 3-(4-bromo-3-methylanilino)-6-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-(4-bromo-3-methylanilino)-6-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43192669 |
| Molecular Formula | C15H12BrFN2O |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 3-(4-bromo-3-methylanilino)-6-fluoro-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(NC2C(=O)Nc3cc(F)ccc32)ccc1Br |
| InChI | InChI=1S/C15H12BrFN2O/c1-8-6-10(3-5-12(8)16)18-14-11-4-2-9(17)7-13(11)19-15(14)20/h2-7,14,18H,1H3,(H,19,20) |
| InChIKey | FVTJUUJUZSYJHY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |