C14H10FIN2O — CID 43124339
6-fluoro-3-(4-iodoanilino)-1,3-dihydroindol-2-one (PubChem CID 43124339) has the molecular formula C14H10FIN2O and a molecular weight of 368.15 g/mol. Its IUPAC name is 6-fluoro-3-(4-iodoanilino)-1,3-dihydroindol-2-one.
| Compound Name | 6-fluoro-3-(4-iodoanilino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43124339 |
| Molecular Formula | C14H10FIN2O |
| Molecular Weight | 368.15 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 6-fluoro-3-(4-iodoanilino)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(F)ccc2C1Nc1ccc(I)cc1 |
| InChI | InChI=1S/C14H10FIN2O/c15-8-1-6-11-12(7-8)18-14(19)13(11)17-10-4-2-9(16)3-5-10/h1-7,13,17H,(H,18,19) |
| InChIKey | QVEKDVSFDOGNGE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.15 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|