C14H9ClF2N2O — CID 43119152
3-(3-chloro-4-fluoroanilino)-5-fluoro-1,3-dihydroindol-2-one (PubChem CID 43119152) has the molecular formula C14H9ClF2N2O and a molecular weight of 294.69 g/mol. Its IUPAC name is 3-(3-chloro-4-fluoroanilino)-5-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-(3-chloro-4-fluoroanilino)-5-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43119152 |
| Molecular Formula | C14H9ClF2N2O |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 3-(3-chloro-4-fluoroanilino)-5-fluoro-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C1Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H9ClF2N2O/c15-10-6-8(2-3-11(10)17)18-13-9-5-7(16)1-4-12(9)19-14(13)20/h1-6,13,18H,(H,19,20) |
| InChIKey | MFYLXWUFGJFMIO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |