C16H11ClN2OS — CID 43687791
3-(1-benzothiophen-5-ylamino)-5-chloro-1,3-dihydroindol-2-one (PubChem CID 43687791) has the molecular formula C16H11ClN2OS and a molecular weight of 314.80 g/mol. Its IUPAC name is 3-(1-benzothiophen-5-ylamino)-5-chloro-1,3-dihydroindol-2-one.
| Compound Name | 3-(1-benzothiophen-5-ylamino)-5-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43687791 |
| Molecular Formula | C16H11ClN2OS |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 3-(1-benzothiophen-5-ylamino)-5-chloro-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C1Nc1ccc2sccc2c1 |
| InChI | InChI=1S/C16H11ClN2OS/c17-10-1-3-13-12(8-10)15(16(20)19-13)18-11-2-4-14-9(7-11)5-6-21-14/h1-8,15,18H,(H,19,20) |
| InChIKey | FBRBFQOPLXEZJI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |