C14H8ClF3N2O — CID 43095076
5-chloro-3-(2,3,4-trifluoroanilino)-1,3-dihydroindol-2-one (PubChem CID 43095076) has the molecular formula C14H8ClF3N2O and a molecular weight of 312.68 g/mol. Its IUPAC name is 5-chloro-3-(2,3,4-trifluoroanilino)-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-3-(2,3,4-trifluoroanilino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43095076 |
| Molecular Formula | C14H8ClF3N2O |
| Molecular Weight | 312.68 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 5-chloro-3-(2,3,4-trifluoroanilino)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C1Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H8ClF3N2O/c15-6-1-3-9-7(5-6)13(14(21)20-9)19-10-4-2-8(16)11(17)12(10)18/h1-5,13,19H,(H,20,21) |
| InChIKey | JOTWGVWBTCJXAD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|